C5H4F7N — CID 130418375
(Z)-1,3,3,3-tetrafluoro-N-methyl-N-(trifluoromethyl)prop-1-en-2-amine (PubChem CID 130418375) has the molecular formula C5H4F7N and a molecular weight of 211.08 g/mol. Its IUPAC name is (Z)-1,3,3,3-tetrafluoro-N-methyl-N-(trifluoromethyl)prop-1-en-2-amine.
| Compound Name | (Z)-1,3,3,3-tetrafluoro-N-methyl-N-(trifluoromethyl)prop-1-en-2-amine |
|---|---|
| PubChem CID | 130418375 |
| Molecular Formula | C5H4F7N |
| Molecular Weight | 211.08 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | (Z)-1,3,3,3-tetrafluoro-N-methyl-N-(trifluoromethyl)prop-1-en-2-amine |
| SMILES | CN(/C(=C\F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H4F7N/c1-13(5(10,11)12)3(2-6)4(7,8)9/h2H,1H3/b3-2- |
| InChIKey | YQUIDANWDZWJJX-IHWYPQMZSA-N |
| XLogP | 2.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.08 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|