C13H18F9NO2 — CID 130418389
4-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]morpholine (PubChem CID 130418389) has the molecular formula C13H18F9NO2 and a molecular weight of 391.27 g/mol. Its IUPAC name is 4-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]morpholine.
| Compound Name | 4-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]morpholine |
|---|---|
| PubChem CID | 130418389 |
| Molecular Formula | C13H18F9NO2 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 4-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]morpholine |
| SMILES | CC(OC(C)C(F)(F)C(F)C(F)(F)F)C(F)(F)C(F)N1CCOCC1 |
| InChI | InChI=1S/C13H18F9NO2/c1-7(11(16,17)9(14)13(20,21)22)25-8(2)12(18,19)10(15)23-3-5-24-6-4-23/h7-10H,3-6H2,1-2H3 |
| InChIKey | SQSVYCYNFOCMRD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|