C15H16F15NO2 — CID 130418394
4-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]-2,6-bis(trifluoromethyl)morpholine (PubChem CID 130418394) has the molecular formula C15H16F15NO2 and a molecular weight of 527.27 g/mol. Its IUPAC name is 4-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]-2,6-bis(trifluoromethyl)morpholine.
| Compound Name | 4-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]-2,6-bis(trifluoromethyl)morpholine |
|---|---|
| PubChem CID | 130418394 |
| Molecular Formula | C15H16F15NO2 |
| Molecular Weight | 527.27 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | 4-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]-2,6-bis(trifluoromethyl)morpholine |
| SMILES | CC(OC(C)C(F)(F)C(F)C(F)(F)F)C(F)(F)C(F)N1CC(C(F)(F)F)OC(C(F)(F)F)C1 |
| InChI | InChI=1S/C15H16F15NO2/c1-5(11(18,19)9(16)15(28,29)30)32-6(2)12(20,21)10(17)31-3-7(13(22,23)24)33-8(4-31)14(25,26)27/h5-10H,3-4H2,1-2H3 |
| InChIKey | OYBRBIAOTWQIES-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.27 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|