C15H18F14N2O — CID 130418397
1-[1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butyl]-4-(trifluoromethyl)piperazine (PubChem CID 130418397) has the molecular formula C15H18F14N2O and a molecular weight of 508.29 g/mol. Its IUPAC name is 1-[1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butyl]-4-(trifluoromethyl)piperazine.
| Compound Name | 1-[1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butyl]-4-(trifluoromethyl)piperazine |
|---|---|
| PubChem CID | 130418397 |
| Molecular Formula | C15H18F14N2O |
| Molecular Weight | 508.29 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 1-[1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butyl]-4-(trifluoromethyl)piperazine |
| SMILES | CC(OC(C)C(F)(C(F)N1CCN(C(F)(F)F)CC1)C(F)(F)F)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C15H18F14N2O/c1-7(32-8(2)12(19,20)9(16)13(21,22)23)11(18,14(24,25)26)10(17)30-3-5-31(6-4-30)15(27,28)29/h7-10H,3-6H2,1-2H3 |
| InChIKey | TWUVLEOUVYJQCV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.29 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|