C17H18F17NO — CID 130418398
1-[1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butyl]-3,5-bis(trifluoromethyl)piperidine (PubChem CID 130418398) has the molecular formula C17H18F17NO and a molecular weight of 575.30 g/mol. Its IUPAC name is 1-[1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butyl]-3,5-bis(trifluoromethyl)piperidine.
| Compound Name | 1-[1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butyl]-3,5-bis(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 130418398 |
| Molecular Formula | C17H18F17NO |
| Molecular Weight | 575.30 g/mol |
| Exact Mass | 575.11 |
| IUPAC Name | 1-[1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butyl]-3,5-bis(trifluoromethyl)piperidine |
| SMILES | CC(OC(C)C(F)(C(F)N1CC(C(F)(F)F)CC(C(F)(F)F)C1)C(F)(F)F)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C17H18F17NO/c1-6(36-7(2)13(21,22)10(18)16(29,30)31)12(20,17(32,33)34)11(19)35-4-8(14(23,24)25)3-9(5-35)15(26,27)28/h6-11H,3-5H2,1-2H3 |
| InChIKey | SXZYMMSQHXUIMY-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.30 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|