C16H24F9NO — CID 130418421
1-[1,2-difluoro-3-(3,3,4,5-tetrafluoropentan-2-yloxy)-2-(trifluoromethyl)butyl]azepane (PubChem CID 130418421) has the molecular formula C16H24F9NO and a molecular weight of 417.36 g/mol. Its IUPAC name is 1-[1,2-difluoro-3-(3,3,4,5-tetrafluoropentan-2-yloxy)-2-(trifluoromethyl)butyl]azepane.
| Compound Name | 1-[1,2-difluoro-3-(3,3,4,5-tetrafluoropentan-2-yloxy)-2-(trifluoromethyl)butyl]azepane |
|---|---|
| PubChem CID | 130418421 |
| Molecular Formula | C16H24F9NO |
| Molecular Weight | 417.36 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 1-[1,2-difluoro-3-(3,3,4,5-tetrafluoropentan-2-yloxy)-2-(trifluoromethyl)butyl]azepane |
| SMILES | CC(OC(C)C(F)(C(F)N1CCCCCC1)C(F)(F)F)C(F)(F)C(F)CF |
| InChI | InChI=1S/C16H24F9NO/c1-10(27-11(2)15(21,22)12(18)9-17)14(20,16(23,24)25)13(19)26-7-5-3-4-6-8-26/h10-13H,3-9H2,1-2H3 |
| InChIKey | SMLHUEDFVRECRY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.36 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|