C16H16F17NO2 — CID 130418422
4-[1,1,1,3,3-pentafluoro-4-[(2R,4R)-3,3,4,5,5,5-hexafluoropentan-2-yl]oxypentan-2-yl]-2,6-bis(trifluoromethyl)morpholine (PubChem CID 130418422) has the molecular formula C16H16F17NO2 and a molecular weight of 577.28 g/mol. Its IUPAC name is 4-[1,1,1,3,3-pentafluoro-4-[(2R,4R)-3,3,4,5,5,5-hexafluoropentan-2-yl]oxypentan-2-yl]-2,6-bis(trifluoromethyl)morpholine.
| Compound Name | 4-[1,1,1,3,3-pentafluoro-4-[(2R,4R)-3,3,4,5,5,5-hexafluoropentan-2-yl]oxypentan-2-yl]-2,6-bis(trifluoromethyl)morpholine |
|---|---|
| PubChem CID | 130418422 |
| Molecular Formula | C16H16F17NO2 |
| Molecular Weight | 577.28 g/mol |
| Exact Mass | 577.09 |
| IUPAC Name | 4-[1,1,1,3,3-pentafluoro-4-[(2R,4R)-3,3,4,5,5,5-hexafluoropentan-2-yl]oxypentan-2-yl]-2,6-bis(trifluoromethyl)morpholine |
| SMILES | CC(O[C@H](C)C(F)(F)[C@@H](F)C(F)(F)F)C(F)(F)C(N1CC(C(F)(F)F)OC(C(F)(F)F)C1)C(F)(F)F |
| InChI | InChI=1S/C16H16F17NO2/c1-5(11(18,19)9(17)15(28,29)30)35-6(2)12(20,21)10(16(31,32)33)34-3-7(13(22,23)24)36-8(4-34)14(25,26)27/h5-10H,3-4H2,1-2H3/t5-,6?,7?,8?,9-,10?/m1/s1 |
| InChIKey | WHCCJFQJDDNRCR-DDLDGWCESA-N |
| XLogP | 6.08 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.28 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |