C16H23F11N2O — CID 130418423
1-(azepan-1-yl)-1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butan-1-amine (PubChem CID 130418423) has the molecular formula C16H23F11N2O and a molecular weight of 468.35 g/mol. Its IUPAC name is 1-(azepan-1-yl)-1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butan-1-amine.
| Compound Name | 1-(azepan-1-yl)-1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butan-1-amine |
|---|---|
| PubChem CID | 130418423 |
| Molecular Formula | C16H23F11N2O |
| Molecular Weight | 468.35 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 1-(azepan-1-yl)-1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butan-1-amine |
| SMILES | CC(OC(C)C(F)(C(F)(F)F)C(N)(F)N1CCCCCC1)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C16H23F11N2O/c1-9(12(18,19)11(17)14(21,22)23)30-10(2)13(20,15(24,25)26)16(27,28)29-7-5-3-4-6-8-29/h9-11H,3-8,28H2,1-2H3 |
| InChIKey | ISCDJBQSQVLDRI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.35 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|