C10H6F17NO — CID 130418433
1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)-N,N-bis(trifluoromethyl)propan-1-amine (PubChem CID 130418433) has the molecular formula C10H6F17NO and a molecular weight of 479.13 g/mol. Its IUPAC name is 1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)-N,N-bis(trifluoromethyl)propan-1-amine.
| Compound Name | 1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)-N,N-bis(trifluoromethyl)propan-1-amine |
|---|---|
| PubChem CID | 130418433 |
| Molecular Formula | C10H6F17NO |
| Molecular Weight | 479.13 g/mol |
| Exact Mass | 479.02 |
| IUPAC Name | 1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)-N,N-bis(trifluoromethyl)propan-1-amine |
| SMILES | FC(C(F)(F)F)C(F)(F)COCC(F)(C(F)N(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H6F17NO/c11-3(7(16,17)18)6(14,15)2-29-1-5(13,8(19,20)21)4(12)28(9(22,23)24)10(25,26)27/h3-4H,1-2H2 |
| InChIKey | SNSPJLCSOICQMG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.13 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|