C17H18F17NO — CID 130418434
1-[1,1,1,3,3-pentafluoro-4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)pentan-2-yl]-3,5-bis(trifluoromethyl)piperidine (PubChem CID 130418434) has the molecular formula C17H18F17NO and a molecular weight of 575.30 g/mol. Its IUPAC name is 1-[1,1,1,3,3-pentafluoro-4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)pentan-2-yl]-3,5-bis(trifluoromethyl)piperidine.
| Compound Name | 1-[1,1,1,3,3-pentafluoro-4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)pentan-2-yl]-3,5-bis(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 130418434 |
| Molecular Formula | C17H18F17NO |
| Molecular Weight | 575.30 g/mol |
| Exact Mass | 575.11 |
| IUPAC Name | 1-[1,1,1,3,3-pentafluoro-4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)pentan-2-yl]-3,5-bis(trifluoromethyl)piperidine |
| SMILES | CC(OC(C)C(F)(F)C(N1CC(C(F)(F)F)CC(C(F)(F)F)C1)C(F)(F)F)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C17H18F17NO/c1-6(12(19,20)10(18)16(29,30)31)36-7(2)13(21,22)11(17(32,33)34)35-4-8(14(23,24)25)3-9(5-35)15(26,27)28/h6-11H,3-5H2,1-2H3 |
| InChIKey | QOBRQTUKPUNRPF-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.30 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |