C16H19F14NO — CID 130418435
1-[1,1,1,3,3-pentafluoro-4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)pentan-2-yl]-4-(trifluoromethyl)piperidine (PubChem CID 130418435) has the molecular formula C16H19F14NO and a molecular weight of 507.31 g/mol. Its IUPAC name is 1-[1,1,1,3,3-pentafluoro-4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)pentan-2-yl]-4-(trifluoromethyl)piperidine.
| Compound Name | 1-[1,1,1,3,3-pentafluoro-4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)pentan-2-yl]-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 130418435 |
| Molecular Formula | C16H19F14NO |
| Molecular Weight | 507.31 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | 1-[1,1,1,3,3-pentafluoro-4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)pentan-2-yl]-4-(trifluoromethyl)piperidine |
| SMILES | CC(OC(C)C(F)(F)C(N1CCC(C(F)(F)F)CC1)C(F)(F)F)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C16H19F14NO/c1-7(12(18,19)10(17)15(25,26)27)32-8(2)13(20,21)11(16(28,29)30)31-5-3-9(4-6-31)14(22,23)24/h7-11H,3-6H2,1-2H3 |
| InChIKey | FIZPYGAUEJECFF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.31 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |