C15H21F11N2O — CID 130418442
1-methyl-4-[1,1,1,3,3-pentafluoro-4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)pentan-2-yl]piperazine (PubChem CID 130418442) has the molecular formula C15H21F11N2O and a molecular weight of 454.32 g/mol. Its IUPAC name is 1-methyl-4-[1,1,1,3,3-pentafluoro-4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)pentan-2-yl]piperazine.
| Compound Name | 1-methyl-4-[1,1,1,3,3-pentafluoro-4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)pentan-2-yl]piperazine |
|---|---|
| PubChem CID | 130418442 |
| Molecular Formula | C15H21F11N2O |
| Molecular Weight | 454.32 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 1-methyl-4-[1,1,1,3,3-pentafluoro-4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)pentan-2-yl]piperazine |
| SMILES | CC(OC(C)C(F)(F)C(N1CCN(C)CC1)C(F)(F)F)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C15H21F11N2O/c1-8(12(17,18)10(16)14(21,22)23)29-9(2)13(19,20)11(15(24,25)26)28-6-4-27(3)5-7-28/h8-11H,4-7H2,1-3H3 |
| InChIKey | YVWSSZNORPDRIC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |