C13H17F11N2O — CID 130418448
1-methyl-4-[1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)propyl]piperazine (PubChem CID 130418448) has the molecular formula C13H17F11N2O and a molecular weight of 426.27 g/mol. Its IUPAC name is 1-methyl-4-[1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)propyl]piperazine.
| Compound Name | 1-methyl-4-[1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)propyl]piperazine |
|---|---|
| PubChem CID | 130418448 |
| Molecular Formula | C13H17F11N2O |
| Molecular Weight | 426.27 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 1-methyl-4-[1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)propyl]piperazine |
| SMILES | CN1CCN(C(F)C(F)(COCC(F)(F)C(F)C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H17F11N2O/c1-25-2-4-26(5-3-25)9(15)10(16,13(22,23)24)6-27-7-11(17,18)8(14)12(19,20)21/h8-9H,2-7H2,1H3 |
| InChIKey | QSLXEINTPFVLSO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|