C14H18F11NO — CID 130418450
1-[(1S)-1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)propyl]azepane (PubChem CID 130418450) has the molecular formula C14H18F11NO and a molecular weight of 425.28 g/mol. Its IUPAC name is 1-[(1S)-1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)propyl]azepane.
| Compound Name | 1-[(1S)-1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)propyl]azepane |
|---|---|
| PubChem CID | 130418450 |
| Molecular Formula | C14H18F11NO |
| Molecular Weight | 425.28 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 1-[(1S)-1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)propyl]azepane |
| SMILES | FC(C(F)(F)F)C(F)(F)COCC(F)([C@H](F)N1CCCCCC1)C(F)(F)F |
| InChI | InChI=1S/C14H18F11NO/c15-9(13(20,21)22)12(18,19)8-27-7-11(17,14(23,24)25)10(16)26-5-3-1-2-4-6-26/h9-10H,1-8H2/t9?,10-,11?/m1/s1 |
| InChIKey | MGQWPSBAVLKVBX-HSOILSAZSA-N |
| XLogP | 4.98 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.28 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|