C11H14F9NO — CID 130418455
1-[(1R)-1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]pyrrolidine (PubChem CID 130418455) has the molecular formula C11H14F9NO and a molecular weight of 347.22 g/mol. Its IUPAC name is 1-[(1R)-1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]pyrrolidine.
| Compound Name | 1-[(1R)-1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]pyrrolidine |
|---|---|
| PubChem CID | 130418455 |
| Molecular Formula | C11H14F9NO |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 1-[(1R)-1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]pyrrolidine |
| SMILES | FC(C(F)(F)F)C(F)(F)COCC(F)(F)[C@@H](F)N1CCCC1 |
| InChI | InChI=1S/C11H14F9NO/c12-7(11(18,19)20)9(14,15)5-22-6-10(16,17)8(13)21-3-1-2-4-21/h7-8H,1-6H2/t7?,8-/m0/s1 |
| InChIKey | OFNKKPKHHKAMJD-MQWKRIRWSA-N |
| XLogP | 3.57 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|