C24H36F2N6O4 — CID 130418629
2-[(2S,3R,4R,5S)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[[(3R)-3-[(3,3-difluoropyrrolidin-1-yl)methyl]morpholin-4-yl]methyl]-4-methyloxolan-3-yl]oxypropan-2-ol (PubChem CID 130418629) has the molecular formula C24H36F2N6O4 and a molecular weight of 510.59 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5S)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[[(3R)-3-[(3,3-difluoropyrrolidin-1-yl)methyl]morpholin-4-yl]methyl]-4-methyloxolan-3-yl]oxypropan-2-ol.
| Compound Name | 2-[(2S,3R,4R,5S)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[[(3R)-3-[(3,3-difluoropyrrolidin-1-yl)methyl]morpholin-4-yl]methyl]-4-methyloxolan-3-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 130418629 |
| Molecular Formula | C24H36F2N6O4 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | 2-[(2S,3R,4R,5S)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[[(3R)-3-[(3,3-difluoropyrrolidin-1-yl)methyl]morpholin-4-yl]methyl]-4-methyloxolan-3-yl]oxypropan-2-ol |
| SMILES | C[C@H]1[C@@H](OC(C)(C)O)[C@H](c2ccc3c(N)ncnn23)O[C@@H]1CN1CCOC[C@H]1CN1CCC(F)(F)C1 |
| InChI | InChI=1S/C24H36F2N6O4/c1-15-19(11-31-8-9-34-12-16(31)10-30-7-6-24(25,26)13-30)35-21(20(15)36-23(2,3)33)17-4-5-18-22(27)28-14-29-32(17)18/h4-5,14-16,19-21,33H,6-13H2,1-3H3,(H2,27,28,29)/t15-,16-,19-,20-,21+/m1/s1 |
| InChIKey | PUJUDTMVMUZBPJ-VQDSBOJYSA-N |
| XLogP | 1.54 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|