C27H42F2N6O5 — CID 130418632
tert-butyl N-[2-[(2R)-1-[[(2S,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-(2-hydroxypropan-2-yloxy)-3-methyloxolan-2-yl]methyl]-4,4-difluoropiperidin-2-yl]ethyl]carbamate (PubChem CID 130418632) has the molecular formula C27H42F2N6O5 and a molecular weight of 568.67 g/mol. Its IUPAC name is tert-butyl N-[2-[(2R)-1-[[(2S,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-(2-hydroxypropan-2-yloxy)-3-methyloxolan-2-yl]methyl]-4,4-difluoropiperidin-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2R)-1-[[(2S,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-(2-hydroxypropan-2-yloxy)-3-methyloxolan-2-yl]methyl]-4,4-difluoropiperidin-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 130418632 |
| Molecular Formula | C27H42F2N6O5 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.32 |
| IUPAC Name | tert-butyl N-[2-[(2R)-1-[[(2S,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-(2-hydroxypropan-2-yloxy)-3-methyloxolan-2-yl]methyl]-4,4-difluoropiperidin-2-yl]ethyl]carbamate |
| SMILES | C[C@H]1[C@@H](OC(C)(C)O)[C@H](c2ccc3c(N)ncnn23)O[C@@H]1CN1CCC(F)(F)C[C@H]1CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H42F2N6O5/c1-16-20(14-34-12-10-27(28,29)13-17(34)9-11-31-24(36)40-25(2,3)4)38-22(21(16)39-26(5,6)37)18-7-8-19-23(30)32-15-33-35(18)19/h7-8,15-17,20-22,37H,9-14H2,1-6H3,(H,31,36)(H2,30,32,33)/t16-,17-,20-,21-,22+/m1/s1 |
| InChIKey | INTAGYCQBCAEAC-QFOSDGOKSA-N |
| XLogP | 3.52 |
| TPSA | 136.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|