C24H35F2N5O3S — CID 130418640
2-[(2R,3S,4S,5R)-2-[[(2S)-2-[(dimethylamino)methyl]-4,4-difluoropyrrolidin-1-yl]methyl]-4-ethenyl-5-(4-methylsulfanylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-3-yl]oxypropan-2-ol (PubChem CID 130418640) has the molecular formula C24H35F2N5O3S and a molecular weight of 511.64 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5R)-2-[[(2S)-2-[(dimethylamino)methyl]-4,4-difluoropyrrolidin-1-yl]methyl]-4-ethenyl-5-(4-methylsulfanylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-3-yl]oxypropan-2-ol.
| Compound Name | 2-[(2R,3S,4S,5R)-2-[[(2S)-2-[(dimethylamino)methyl]-4,4-difluoropyrrolidin-1-yl]methyl]-4-ethenyl-5-(4-methylsulfanylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-3-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 130418640 |
| Molecular Formula | C24H35F2N5O3S |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 2-[(2R,3S,4S,5R)-2-[[(2S)-2-[(dimethylamino)methyl]-4,4-difluoropyrrolidin-1-yl]methyl]-4-ethenyl-5-(4-methylsulfanylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-3-yl]oxypropan-2-ol |
| SMILES | C=C[C@@H]1[C@H](OC(C)(C)O)[C@@H](CN2CC(F)(F)C[C@H]2CN(C)C)O[C@H]1c1ccc2c(SC)ncnn12 |
| InChI | InChI=1S/C24H35F2N5O3S/c1-7-16-20(17-8-9-18-22(35-6)27-14-28-31(17)18)33-19(21(16)34-23(2,3)32)12-30-13-24(25,26)10-15(30)11-29(4)5/h7-9,14-16,19-21,32H,1,10-13H2,2-6H3/t15-,16-,19+,20+,21-/m0/s1 |
| InChIKey | NFJAUVUDMRPSOO-KHDMTIDOSA-N |
| XLogP | 3.08 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|