C27H39F2N5O4S — CID 130418641
2-[(2S,3R,4R,5S)-5-[[(2R)-4,4-difluoro-2-(2-morpholin-4-ylethyl)pyrrolidin-1-yl]methyl]-4-ethenyl-2-(4-methylsulfanylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-3-yl]oxypropan-2-ol (PubChem CID 130418641) has the molecular formula C27H39F2N5O4S and a molecular weight of 567.70 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5S)-5-[[(2R)-4,4-difluoro-2-(2-morpholin-4-ylethyl)pyrrolidin-1-yl]methyl]-4-ethenyl-2-(4-methylsulfanylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-3-yl]oxypropan-2-ol.
| Compound Name | 2-[(2S,3R,4R,5S)-5-[[(2R)-4,4-difluoro-2-(2-morpholin-4-ylethyl)pyrrolidin-1-yl]methyl]-4-ethenyl-2-(4-methylsulfanylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-3-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 130418641 |
| Molecular Formula | C27H39F2N5O4S |
| Molecular Weight | 567.70 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | 2-[(2S,3R,4R,5S)-5-[[(2R)-4,4-difluoro-2-(2-morpholin-4-ylethyl)pyrrolidin-1-yl]methyl]-4-ethenyl-2-(4-methylsulfanylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-3-yl]oxypropan-2-ol |
| SMILES | C=C[C@H]1[C@@H](OC(C)(C)O)[C@H](c2ccc3c(SC)ncnn23)O[C@@H]1CN1CC(F)(F)C[C@H]1CCN1CCOCC1 |
| InChI | InChI=1S/C27H39F2N5O4S/c1-5-19-22(15-33-16-27(28,29)14-18(33)8-9-32-10-12-36-13-11-32)37-24(23(19)38-26(2,3)35)20-6-7-21-25(39-4)30-17-31-34(20)21/h5-7,17-19,22-24,35H,1,8-16H2,2-4H3/t18-,19-,22-,23-,24+/m1/s1 |
| InChIKey | UANPCIINJUHTBH-UOBOAIMASA-N |
| XLogP | 3.24 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.70 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|