C24H37F2N5O3S — CID 130418643
2-[(2S,3R,4R,5S)-5-[[(2R)-2-[2-(dimethylamino)ethyl]-4,4-difluoropyrrolidin-1-yl]methyl]-4-methyl-2-(4-methylsulfanylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-3-yl]oxypropan-2-ol (PubChem CID 130418643) has the molecular formula C24H37F2N5O3S and a molecular weight of 513.66 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5S)-5-[[(2R)-2-[2-(dimethylamino)ethyl]-4,4-difluoropyrrolidin-1-yl]methyl]-4-methyl-2-(4-methylsulfanylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-3-yl]oxypropan-2-ol.
| Compound Name | 2-[(2S,3R,4R,5S)-5-[[(2R)-2-[2-(dimethylamino)ethyl]-4,4-difluoropyrrolidin-1-yl]methyl]-4-methyl-2-(4-methylsulfanylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-3-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 130418643 |
| Molecular Formula | C24H37F2N5O3S |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | 2-[(2S,3R,4R,5S)-5-[[(2R)-2-[2-(dimethylamino)ethyl]-4,4-difluoropyrrolidin-1-yl]methyl]-4-methyl-2-(4-methylsulfanylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-3-yl]oxypropan-2-ol |
| SMILES | CSc1ncnn2c([C@@H]3O[C@H](CN4CC(F)(F)C[C@H]4CCN(C)C)[C@@H](C)[C@H]3OC(C)(C)O)ccc12 |
| InChI | InChI=1S/C24H37F2N5O3S/c1-15-19(12-30-13-24(25,26)11-16(30)9-10-29(4)5)33-21(20(15)34-23(2,3)32)17-7-8-18-22(35-6)27-14-28-31(17)18/h7-8,14-16,19-21,32H,9-13H2,1-6H3/t15-,16-,19-,20-,21+/m1/s1 |
| InChIKey | FJKZYTPWQBMHSR-VQDSBOJYSA-N |
| XLogP | 3.30 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|