C21H30F2N6O4 — CID 130418808
(2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[[(2R)-4,4-difluoro-2-(2-morpholin-4-ylethyl)pyrrolidin-1-yl]methyl]oxolane-3,4-diol (PubChem CID 130418808) has the molecular formula C21H30F2N6O4 and a molecular weight of 468.51 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[[(2R)-4,4-difluoro-2-(2-morpholin-4-ylethyl)pyrrolidin-1-yl]methyl]oxolane-3,4-diol.
| Compound Name | (2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[[(2R)-4,4-difluoro-2-(2-morpholin-4-ylethyl)pyrrolidin-1-yl]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 130418808 |
| Molecular Formula | C21H30F2N6O4 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | (2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[[(2R)-4,4-difluoro-2-(2-morpholin-4-ylethyl)pyrrolidin-1-yl]methyl]oxolane-3,4-diol |
| SMILES | Nc1ncnn2c([C@@H]3O[C@H](CN4CC(F)(F)C[C@H]4CCN4CCOCC4)[C@@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C21H30F2N6O4/c22-21(23)9-13(3-4-27-5-7-32-8-6-27)28(11-21)10-16-17(30)18(31)19(33-16)14-1-2-15-20(24)25-12-26-29(14)15/h1-2,12-13,16-19,30-31H,3-11H2,(H2,24,25,26)/t13-,16-,17-,18-,19+/m1/s1 |
| InChIKey | HBKMEEMPHDGKFJ-PYJZQUQOSA-N |
| XLogP | -0.09 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |