C25H35F5N6O3 — CID 130418818
2-[(2S,3R,4R,5S)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[[3,3-difluoro-8-(2,2,2-trifluoroethyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]-4-methyloxolan-3-yl]oxypropan-2-ol (PubChem CID 130418818) has the molecular formula C25H35F5N6O3 and a molecular weight of 562.58 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5S)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[[3,3-difluoro-8-(2,2,2-trifluoroethyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]-4-methyloxolan-3-yl]oxypropan-2-ol.
| Compound Name | 2-[(2S,3R,4R,5S)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[[3,3-difluoro-8-(2,2,2-trifluoroethyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]-4-methyloxolan-3-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 130418818 |
| Molecular Formula | C25H35F5N6O3 |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 562.27 |
| IUPAC Name | 2-[(2S,3R,4R,5S)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[[3,3-difluoro-8-(2,2,2-trifluoroethyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]-4-methyloxolan-3-yl]oxypropan-2-ol |
| SMILES | C[C@H]1[C@@H](OC(C)(C)O)[C@H](c2ccc3c(N)ncnn23)O[C@@H]1CN1CC(F)(F)CC12CCN(CC(F)(F)F)CC2 |
| InChI | InChI=1S/C25H35F5N6O3/c1-15-18(10-35-12-24(26,27)11-23(35)6-8-34(9-7-23)13-25(28,29)30)38-20(19(15)39-22(2,3)37)16-4-5-17-21(31)32-14-33-36(16)17/h4-5,14-15,18-20,37H,6-13H2,1-3H3,(H2,31,32,33)/t15-,18-,19-,20+/m1/s1 |
| InChIKey | BAXRTSHANKTMCM-XLNTUCKNSA-N |
| XLogP | 3.24 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|