C24H33F5N6O3 — CID 130418826
2-[(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-[[3,3-difluoro-8-(2,2,2-trifluoroethyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]oxolan-3-yl]oxypropan-2-ol (PubChem CID 130418826) has the molecular formula C24H33F5N6O3 and a molecular weight of 548.56 g/mol. Its IUPAC name is 2-[(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-[[3,3-difluoro-8-(2,2,2-trifluoroethyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]oxolan-3-yl]oxypropan-2-ol.
| Compound Name | 2-[(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-[[3,3-difluoro-8-(2,2,2-trifluoroethyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]oxolan-3-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 130418826 |
| Molecular Formula | C24H33F5N6O3 |
| Molecular Weight | 548.56 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | 2-[(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-[[3,3-difluoro-8-(2,2,2-trifluoroethyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]oxolan-3-yl]oxypropan-2-ol |
| SMILES | CC(C)(O)O[C@H]1C[C@H](c2ccc3c(N)ncnn23)O[C@@H]1CN1CC(F)(F)CC12CCN(CC(F)(F)F)CC2 |
| InChI | InChI=1S/C24H33F5N6O3/c1-21(2,36)38-18-9-17(15-3-4-16-20(30)31-14-32-35(15)16)37-19(18)10-34-12-23(25,26)11-22(34)5-7-33(8-6-22)13-24(27,28)29/h3-4,14,17-19,36H,5-13H2,1-2H3,(H2,30,31,32)/t17-,18+,19-/m1/s1 |
| InChIKey | PZDYPSHQTGICAB-CEXWTWQISA-N |
| XLogP | 2.99 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|