C20H27F3N6O3 — CID 130418850
(2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[[2-(trifluoromethyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]oxolane-3,4-diol (PubChem CID 130418850) has the molecular formula C20H27F3N6O3 and a molecular weight of 456.47 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[[2-(trifluoromethyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]oxolane-3,4-diol.
| Compound Name | (2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[[2-(trifluoromethyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 130418850 |
| Molecular Formula | C20H27F3N6O3 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | (2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[[2-(trifluoromethyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]oxolane-3,4-diol |
| SMILES | Nc1ncnn2c([C@@H]3O[C@H](CN4C(C(F)(F)F)CCC45CCNCC5)[C@@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C20H27F3N6O3/c21-20(22,23)14-3-4-19(5-7-25-8-6-19)28(14)9-13-15(30)16(31)17(32-13)11-1-2-12-18(24)26-10-27-29(11)12/h1-2,10,13-17,25,30-31H,3-9H2,(H2,24,26,27)/t13-,14?,15-,16-,17+/m1/s1 |
| InChIKey | ZXJLZRUUMLVJAC-GTGZTVCESA-N |
| XLogP | 0.62 |
| TPSA | 121.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |