C27H35FN6O3 — CID 130418851
(2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[[8-[2-(4-fluorophenyl)ethyl]-1,8-diazaspiro[4.5]decan-1-yl]methyl]oxolane-3,4-diol (PubChem CID 130418851) has the molecular formula C27H35FN6O3 and a molecular weight of 510.61 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[[8-[2-(4-fluorophenyl)ethyl]-1,8-diazaspiro[4.5]decan-1-yl]methyl]oxolane-3,4-diol.
| Compound Name | (2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[[8-[2-(4-fluorophenyl)ethyl]-1,8-diazaspiro[4.5]decan-1-yl]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 130418851 |
| Molecular Formula | C27H35FN6O3 |
| Molecular Weight | 510.61 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | (2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[[8-[2-(4-fluorophenyl)ethyl]-1,8-diazaspiro[4.5]decan-1-yl]methyl]oxolane-3,4-diol |
| SMILES | Nc1ncnn2c([C@@H]3O[C@H](CN4CCCC45CCN(CCc4ccc(F)cc4)CC5)[C@@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C27H35FN6O3/c28-19-4-2-18(3-5-19)8-13-32-14-10-27(11-15-32)9-1-12-33(27)16-22-23(35)24(36)25(37-22)20-6-7-21-26(29)30-17-31-34(20)21/h2-7,17,22-25,35-36H,1,8-16H2,(H2,29,30,31)/t22-,23-,24-,25+/m1/s1 |
| InChIKey | DWHIMHCYXQNOQO-VPBXCIAMSA-N |
| XLogP | 1.79 |
| TPSA | 112.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.61 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |