C19H26F2N6O3 — CID 130418854
(2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[(3,3-difluoro-1,8-diazaspiro[4.5]decan-1-yl)methyl]oxolane-3,4-diol (PubChem CID 130418854) has the molecular formula C19H26F2N6O3 and a molecular weight of 424.45 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[(3,3-difluoro-1,8-diazaspiro[4.5]decan-1-yl)methyl]oxolane-3,4-diol.
| Compound Name | (2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[(3,3-difluoro-1,8-diazaspiro[4.5]decan-1-yl)methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 130418854 |
| Molecular Formula | C19H26F2N6O3 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | (2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[(3,3-difluoro-1,8-diazaspiro[4.5]decan-1-yl)methyl]oxolane-3,4-diol |
| SMILES | Nc1ncnn2c([C@@H]3O[C@H](CN4CC(F)(F)CC45CCNCC5)[C@@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C19H26F2N6O3/c20-19(21)8-18(3-5-23-6-4-18)26(9-19)7-13-14(28)15(29)16(30-13)11-1-2-12-17(22)24-10-25-27(11)12/h1-2,10,13-16,23,28-29H,3-9H2,(H2,22,24,25)/t13-,14-,15-,16+/m1/s1 |
| InChIKey | SJVYGOLQKXLYBV-FPCVCCKLSA-N |
| XLogP | -0.06 |
| TPSA | 121.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |