C16H20ClN3O2 — CID 130418866
2-[(1R,2R,4S)-2-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-4-ethenylcyclopentyl]oxypropan-2-ol (PubChem CID 130418866) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is 2-[(1R,2R,4S)-2-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-4-ethenylcyclopentyl]oxypropan-2-ol.
| Compound Name | 2-[(1R,2R,4S)-2-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-4-ethenylcyclopentyl]oxypropan-2-ol |
|---|---|
| PubChem CID | 130418866 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 2-[(1R,2R,4S)-2-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-4-ethenylcyclopentyl]oxypropan-2-ol |
| SMILES | C=C[C@H]1C[C@@H](n2ccc3c(Cl)ncnc32)[C@H](OC(C)(C)O)C1 |
| InChI | InChI=1S/C16H20ClN3O2/c1-4-10-7-12(13(8-10)22-16(2,3)21)20-6-5-11-14(17)18-9-19-15(11)20/h4-6,9-10,12-13,21H,1,7-8H2,2-3H3/t10-,12+,13+/m0/s1 |
| InChIKey | UZFXLXVEGLZOND-CYZMBNFOSA-N |
| XLogP | 3.34 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|