C27H37ClN6O5 — CID 130419090
tert-butyl 1-[(1R,3R,5R,6R)-5-(6-chloropurin-9-yl)-6,8,8-trimethyl-4,7,9-trioxatricyclo[4.3.0.01,3]nonan-2-yl]-1,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 130419090) has the molecular formula C27H37ClN6O5 and a molecular weight of 561.08 g/mol. Its IUPAC name is tert-butyl 1-[(1R,3R,5R,6R)-5-(6-chloropurin-9-yl)-6,8,8-trimethyl-4,7,9-trioxatricyclo[4.3.0.01,3]nonan-2-yl]-1,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl 1-[(1R,3R,5R,6R)-5-(6-chloropurin-9-yl)-6,8,8-trimethyl-4,7,9-trioxatricyclo[4.3.0.01,3]nonan-2-yl]-1,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 130419090 |
| Molecular Formula | C27H37ClN6O5 |
| Molecular Weight | 561.08 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | tert-butyl 1-[(1R,3R,5R,6R)-5-(6-chloropurin-9-yl)-6,8,8-trimethyl-4,7,9-trioxatricyclo[4.3.0.01,3]nonan-2-yl]-1,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCCN2C2[C@H]3O[C@@H](n4cnc5c(Cl)ncnc54)[C@]4(C)OC(C)(C)O[C@]234)CC1 |
| InChI | InChI=1S/C27H37ClN6O5/c1-23(2,3)37-22(35)32-12-9-26(10-13-32)8-7-11-34(26)17-18-27(17)25(6,38-24(4,5)39-27)21(36-18)33-15-31-16-19(28)29-14-30-20(16)33/h14-15,17-18,21H,7-13H2,1-6H3/t17?,18-,21-,25+,27-/m1/s1 |
| InChIKey | VYORDCHWIKXOEC-LZNCDSKLSA-N |
| XLogP | 3.91 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.08 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |