C30H38FN5OS — CID 130419170
1-[[(2S,4S,5R)-4-ethenyl-5-(4-methylsulfanylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl]-8-[2-(4-fluorophenyl)ethyl]-1,8-diazaspiro[4.5]decane (PubChem CID 130419170) has the molecular formula C30H38FN5OS and a molecular weight of 535.73 g/mol. Its IUPAC name is 1-[[(2S,4S,5R)-4-ethenyl-5-(4-methylsulfanylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl]-8-[2-(4-fluorophenyl)ethyl]-1,8-diazaspiro[4.5]decane.
| Compound Name | 1-[[(2S,4S,5R)-4-ethenyl-5-(4-methylsulfanylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl]-8-[2-(4-fluorophenyl)ethyl]-1,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 130419170 |
| Molecular Formula | C30H38FN5OS |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | 1-[[(2S,4S,5R)-4-ethenyl-5-(4-methylsulfanylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl]-8-[2-(4-fluorophenyl)ethyl]-1,8-diazaspiro[4.5]decane |
| SMILES | C=C[C@@H]1C[C@@H](CN2CCCC23CCN(CCc2ccc(F)cc2)CC3)O[C@H]1c1ccc2c(SC)ncnn12 |
| InChI | InChI=1S/C30H38FN5OS/c1-3-23-19-25(37-28(23)26-9-10-27-29(38-2)32-21-33-36(26)27)20-35-15-4-12-30(35)13-17-34(18-14-30)16-11-22-5-7-24(31)8-6-22/h3,5-10,21,23,25,28H,1,4,11-20H2,2H3/t23-,25+,28-/m1/s1 |
| InChIKey | RCFVBDGQBIWCID-FKIGELJASA-N |
| XLogP | 5.40 |
| TPSA | 45.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|