C6H9F5N+ — CID 13041984
trimethyl(1,1,2,3,3-pentafluoroprop-2-enyl)azanium (PubChem CID 13041984) has the molecular formula C6H9F5N+ and a molecular weight of 190.13 g/mol. Its IUPAC name is trimethyl(1,1,2,3,3-pentafluoroprop-2-enyl)azanium.
| Compound Name | trimethyl(1,1,2,3,3-pentafluoroprop-2-enyl)azanium |
|---|---|
| PubChem CID | 13041984 |
| Molecular Formula | C6H9F5N+ |
| Molecular Weight | 190.13 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | trimethyl(1,1,2,3,3-pentafluoroprop-2-enyl)azanium |
| SMILES | C[N+](C)(C)C(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C6H9F5N/c1-12(2,3)6(10,11)4(7)5(8)9/h1-3H3/q+1 |
| InChIKey | SRKBYXDWSMNGBF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.13 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|