C6HF5S — CID 13042
2,3,4,5,6-pentafluorobenzenethiol (PubChem CID 13042) has the molecular formula C6HF5S and a molecular weight of 200.13 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluorobenzenethiol.
| Compound Name | 2,3,4,5,6-pentafluorobenzenethiol |
|---|---|
| PubChem CID | 13042 |
| Molecular Formula | C6HF5S |
| Molecular Weight | 200.13 g/mol |
| Exact Mass | 199.97 |
| IUPAC Name | 2,3,4,5,6-pentafluorobenzenethiol |
| SMILES | Fc1c(F)c(F)c(S)c(F)c1F |
| InChI | InChI=1S/C6HF5S/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
| InChIKey | UVAMFBJPMUMURT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.13 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|