C12H15NO2S — CID 130420405
4-cyclohexa-1,3-dien-1-ylsulfonylcyclohexa-1,3-dien-1-amine (PubChem CID 130420405) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 4-cyclohexa-1,3-dien-1-ylsulfonylcyclohexa-1,3-dien-1-amine.
| Compound Name | 4-cyclohexa-1,3-dien-1-ylsulfonylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 130420405 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 4-cyclohexa-1,3-dien-1-ylsulfonylcyclohexa-1,3-dien-1-amine |
| SMILES | NC1=CC=C(S(=O)(=O)C2=CC=CCC2)CC1 |
| InChI | InChI=1S/C12H15NO2S/c13-10-6-8-12(9-7-10)16(14,15)11-4-2-1-3-5-11/h1-2,4,6,8H,3,5,7,9,13H2 |
| InChIKey | QLASGRHGBIKFBC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |