About 2-(2-methylpropyl)-4-propan-2-yl-1,4-thiazinane 1-oxide
2-(2-methylpropyl)-4-propan-2-yl-1,4-thiazinane 1-oxide (PubChem CID 130420800) has the molecular formula C11H23NOS
and a molecular weight of 217.38 g/mol. Its IUPAC name is 2-(2-methylpropyl)-4-propan-2-yl-1,4-thiazinane 1-oxide.
Molecular Properties
| Compound Name | 2-(2-methylpropyl)-4-propan-2-yl-1,4-thiazinane 1-oxide |
| PubChem CID | 130420800 |
| Molecular Formula | C11H23NOS |
| Molecular Weight | 217.38 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 2-(2-methylpropyl)-4-propan-2-yl-1,4-thiazinane 1-oxide |
| SMILES | CC(C)CC1CN(C(C)C)CCS1=O |
| InChI | InChI=1S/C11H23NOS/c1-9(2)7-11-8-12(10(3)4)5-6-14(11)13/h9-11H,5-8H2,1-4H3 |
| InChIKey | GGDUSDSFJQGLJY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-methylpropyl)-4-propan-2-yl-1,4-thiazinane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylpropyl)-4-propan-2-yl-1,4-thiazinane 1-oxide?
The IUPAC name of 2-(2-methylpropyl)-4-propan-2-yl-1,4-thiazinane 1-oxide (CID 130420800) is 2-(2-methylpropyl)-4-propan-2-yl-1,4-thiazinane 1-oxide.
What is the SMILES notation for 2-(2-methylpropyl)-4-propan-2-yl-1,4-thiazinane 1-oxide?
The canonical SMILES for 2-(2-methylpropyl)-4-propan-2-yl-1,4-thiazinane 1-oxide is CC(C)CC1CN(C(C)C)CCS1=O.
What is the InChIKey of 2-(2-methylpropyl)-4-propan-2-yl-1,4-thiazinane 1-oxide?
The InChIKey is GGDUSDSFJQGLJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NOS/c1-9(2)7-11-8-12(10(3)4)5-6-14(11)13/h9-11H,5-8H2,1-4H3.
What are the key properties of 2-(2-methylpropyl)-4-propan-2-yl-1,4-thiazinane 1-oxide?
2-(2-methylpropyl)-4-propan-2-yl-1,4-thiazinane 1-oxide has a molecular weight of 217.38 g/mol, XLogP of 1.87, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylpropyl)-4-propan-2-yl-1,4-thiazinane 1-oxide is sourced from PubChem (CID 130420800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).