About 3-(1-aminoethenyl)-6,7-dihydroquinolin-2-amine
3-(1-aminoethenyl)-6,7-dihydroquinolin-2-amine (PubChem CID 130421119) has the molecular formula C11H13N3
and a molecular weight of 187.25 g/mol. Its IUPAC name is 3-(1-aminoethenyl)-6,7-dihydroquinolin-2-amine.
Molecular Properties
| Compound Name | 3-(1-aminoethenyl)-6,7-dihydroquinolin-2-amine |
| PubChem CID | 130421119 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 3-(1-aminoethenyl)-6,7-dihydroquinolin-2-amine |
| SMILES | C=C(N)c1cc2c(nc1N)=CCCC=2 |
| InChI | InChI=1S/C11H13N3/c1-7(12)9-6-8-4-2-3-5-10(8)14-11(9)13/h4-6H,1-3,12H2,(H2,13,14) |
| InChIKey | FFIGMXVVDVBXQN-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1-aminoethenyl)-6,7-dihydroquinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-aminoethenyl)-6,7-dihydroquinolin-2-amine?
The IUPAC name of 3-(1-aminoethenyl)-6,7-dihydroquinolin-2-amine (CID 130421119) is 3-(1-aminoethenyl)-6,7-dihydroquinolin-2-amine.
What is the SMILES notation for 3-(1-aminoethenyl)-6,7-dihydroquinolin-2-amine?
The canonical SMILES for 3-(1-aminoethenyl)-6,7-dihydroquinolin-2-amine is C=C(N)c1cc2c(nc1N)=CCCC=2.
What is the InChIKey of 3-(1-aminoethenyl)-6,7-dihydroquinolin-2-amine?
The InChIKey is FFIGMXVVDVBXQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3/c1-7(12)9-6-8-4-2-3-5-10(8)14-11(9)13/h4-6H,1-3,12H2,(H2,13,14).
What are the key properties of 3-(1-aminoethenyl)-6,7-dihydroquinolin-2-amine?
3-(1-aminoethenyl)-6,7-dihydroquinolin-2-amine has a molecular weight of 187.25 g/mol, XLogP of -0.05, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-aminoethenyl)-6,7-dihydroquinolin-2-amine is sourced from PubChem (CID 130421119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).