C21H17F2N3O3 — CID 130421469
4-[2-(benzylamino)-2-oxoacetyl]-N-(3,4-difluorophenyl)-1-methylpyrrole-2-carboxamide (PubChem CID 130421469) has the molecular formula C21H17F2N3O3 and a molecular weight of 397.38 g/mol. Its IUPAC name is 4-[2-(benzylamino)-2-oxoacetyl]-N-(3,4-difluorophenyl)-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-[2-(benzylamino)-2-oxoacetyl]-N-(3,4-difluorophenyl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 130421469 |
| Molecular Formula | C21H17F2N3O3 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 4-[2-(benzylamino)-2-oxoacetyl]-N-(3,4-difluorophenyl)-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(C(=O)C(=O)NCc2ccccc2)cc1C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H17F2N3O3/c1-26-12-14(19(27)21(29)24-11-13-5-3-2-4-6-13)9-18(26)20(28)25-15-7-8-16(22)17(23)10-15/h2-10,12H,11H2,1H3,(H,24,29)(H,25,28) |
| InChIKey | DUCQVGRWDLXHBC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|