About 2-[4-[(1S)-1-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-2-hydroxyethyl]phenyl]acetic acid
2-[4-[(1S)-1-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-2-hydroxyethyl]phenyl]acetic acid (PubChem CID 130421733) has the molecular formula C20H18Cl2N2O4
and a molecular weight of 421.28 g/mol. Its IUPAC name is 2-[4-[(1S)-1-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-2-hydroxyethyl]phenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-[(1S)-1-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-2-hydroxyethyl]phenyl]acetic acid |
| PubChem CID | 130421733 |
| Molecular Formula | C20H18Cl2N2O4 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 2-[4-[(1S)-1-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-2-hydroxyethyl]phenyl]acetic acid |
| SMILES | Cn1c(C(=O)N[C@H](CO)c2ccc(CC(=O)O)cc2)cc2c(Cl)c(Cl)ccc21 |
| InChI | InChI=1S/C20H18Cl2N2O4/c1-24-16-7-6-14(21)19(22)13(16)9-17(24)20(28)23-15(10-25)12-4-2-11(3-5-12)8-18(26)27/h2-7,9,15,25H,8,10H2,1H3,(H,23,28)(H,26,27)/t15-/m1/s1 |
| InChIKey | DOBUXSLVZYZCSN-OAHLLOKOSA-N |
| XLogP | 3.58 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-[(1S)-1-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-2-hydroxyethyl]phenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(1S)-1-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-2-hydroxyethyl]phenyl]acetic acid?
The IUPAC name of 2-[4-[(1S)-1-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-2-hydroxyethyl]phenyl]acetic acid (CID 130421733) is 2-[4-[(1S)-1-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-2-hydroxyethyl]phenyl]acetic acid.
What is the SMILES notation for 2-[4-[(1S)-1-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-2-hydroxyethyl]phenyl]acetic acid?
The canonical SMILES for 2-[4-[(1S)-1-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-2-hydroxyethyl]phenyl]acetic acid is Cn1c(C(=O)N[C@H](CO)c2ccc(CC(=O)O)cc2)cc2c(Cl)c(Cl)ccc21.
What is the InChIKey of 2-[4-[(1S)-1-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-2-hydroxyethyl]phenyl]acetic acid?
The InChIKey is DOBUXSLVZYZCSN-OAHLLOKOSA-N. The full InChI is InChI=1S/C20H18Cl2N2O4/c1-24-16-7-6-14(21)19(22)13(16)9-17(24)20(28)23-15(10-25)12-4-2-11(3-5-12)8-18(26)27/h2-7,9,15,25H,8,10H2,1H3,(H,23,28)(H,26,27)/t15-/m1/s1.
What are the key properties of 2-[4-[(1S)-1-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-2-hydroxyethyl]phenyl]acetic acid?
2-[4-[(1S)-1-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-2-hydroxyethyl]phenyl]acetic acid has a molecular weight of 421.28 g/mol, XLogP of 3.58, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(1S)-1-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-2-hydroxyethyl]phenyl]acetic acid is sourced from PubChem (CID 130421733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).