C25H30Br2N8S2 — CID 130422007
N,N'-bis[3-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]propane-1,3-diamine dibromide (PubChem CID 130422007) has the molecular formula C25H30Br2N8S2 and a molecular weight of 666.51 g/mol. Its IUPAC name is N,N'-bis[3-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]propane-1,3-diamine dibromide.
| Compound Name | N,N'-bis[3-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]propane-1,3-diamine dibromide |
|---|---|
| PubChem CID | 130422007 |
| Molecular Formula | C25H30Br2N8S2 |
| Molecular Weight | 666.51 g/mol |
| Exact Mass | 664.04 |
| IUPAC Name | N,N'-bis[3-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]propane-1,3-diamine dibromide |
| SMILES | Cc1cc(NCCCNc2ccc(/N=N/c3scc[n+]3C)c(C)c2)ccc1/N=N/c1scc[n+]1C.[Br-].[Br-] |
| InChI | InChI=1S/C25H28N8S2.2BrH/c1-18-16-20(6-8-22(18)28-30-24-32(3)12-14-34-24)26-10-5-11-27-21-7-9-23(19(2)17-21)29-31-25-33(4)13-15-35-25;;/h6-9,12-17H,5,10-11H2,1-4H3;2*1H |
| InChIKey | XURYYTPALOFNFX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.51 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|