C25H34N12O4S — CID 130422834
N,N'-bis[4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]phenyl]-N,N'-dimethylpropane-1,3-diamine sulfate (PubChem CID 130422834) has the molecular formula C25H34N12O4S and a molecular weight of 598.69 g/mol. Its IUPAC name is N,N'-bis[4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]phenyl]-N,N'-dimethylpropane-1,3-diamine sulfate.
| Compound Name | N,N'-bis[4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]phenyl]-N,N'-dimethylpropane-1,3-diamine sulfate |
|---|---|
| PubChem CID | 130422834 |
| Molecular Formula | C25H34N12O4S |
| Molecular Weight | 598.69 g/mol |
| Exact Mass | 598.25 |
| IUPAC Name | N,N'-bis[4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]phenyl]-N,N'-dimethylpropane-1,3-diamine sulfate |
| SMILES | CN(CCCN(C)c1ccc(/N=N/c2n(C)nc[n+]2C)cc1)c1ccc(/N=N/c2n(C)nc[n+]2C)cc1.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C25H34N12.H2O4S/c1-32(22-12-8-20(9-13-22)28-30-24-34(3)18-26-36(24)5)16-7-17-33(2)23-14-10-21(11-15-23)29-31-25-35(4)19-27-37(25)6;1-5(2,3)4/h8-15,18-19H,7,16-17H2,1-6H3;(H2,1,2,3,4)/q+2;/p-2 |
| InChIKey | ICIQEYZBTHEBMK-UHFFFAOYSA-L |
| XLogP | 2.26 |
| TPSA | 179.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.69 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|