About 3-hydroxy-N,6-dimethyl-4-oxopyran-2-carboxamide
3-hydroxy-N,6-dimethyl-4-oxopyran-2-carboxamide (PubChem CID 130423211) has the molecular formula C8H9NO4
and a molecular weight of 183.16 g/mol. Its IUPAC name is 3-hydroxy-N,6-dimethyl-4-oxopyran-2-carboxamide.
Molecular Properties
| Compound Name | 3-hydroxy-N,6-dimethyl-4-oxopyran-2-carboxamide |
| PubChem CID | 130423211 |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 3-hydroxy-N,6-dimethyl-4-oxopyran-2-carboxamide |
| SMILES | CNC(=O)c1oc(C)cc(=O)c1O |
| InChI | InChI=1S/C8H9NO4/c1-4-3-5(10)6(11)7(13-4)8(12)9-2/h3,11H,1-2H3,(H,9,12) |
| InChIKey | PPFCPMWKLIDCFE-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-hydroxy-N,6-dimethyl-4-oxopyran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-N,6-dimethyl-4-oxopyran-2-carboxamide?
The IUPAC name of 3-hydroxy-N,6-dimethyl-4-oxopyran-2-carboxamide (CID 130423211) is 3-hydroxy-N,6-dimethyl-4-oxopyran-2-carboxamide.
What is the SMILES notation for 3-hydroxy-N,6-dimethyl-4-oxopyran-2-carboxamide?
The canonical SMILES for 3-hydroxy-N,6-dimethyl-4-oxopyran-2-carboxamide is CNC(=O)c1oc(C)cc(=O)c1O.
What is the InChIKey of 3-hydroxy-N,6-dimethyl-4-oxopyran-2-carboxamide?
The InChIKey is PPFCPMWKLIDCFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO4/c1-4-3-5(10)6(11)7(13-4)8(12)9-2/h3,11H,1-2H3,(H,9,12).
What are the key properties of 3-hydroxy-N,6-dimethyl-4-oxopyran-2-carboxamide?
3-hydroxy-N,6-dimethyl-4-oxopyran-2-carboxamide has a molecular weight of 183.16 g/mol, XLogP of 0.01, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-N,6-dimethyl-4-oxopyran-2-carboxamide is sourced from PubChem (CID 130423211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).