C18H21ClFN5O8P2 — CID 130423747
[[(2R,3R,4S,5R)-5-[4-(benzylamino)-6-chloropyrazolo[3,4-d]pyrimidin-1-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 130423747) has the molecular formula C18H21ClFN5O8P2 and a molecular weight of 551.79 g/mol. Its IUPAC name is [[(2R,3R,4S,5R)-5-[4-(benzylamino)-6-chloropyrazolo[3,4-d]pyrimidin-1-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3R,4S,5R)-5-[4-(benzylamino)-6-chloropyrazolo[3,4-d]pyrimidin-1-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 130423747 |
| Molecular Formula | C18H21ClFN5O8P2 |
| Molecular Weight | 551.79 g/mol |
| Exact Mass | 551.05 |
| IUPAC Name | [[(2R,3R,4S,5R)-5-[4-(benzylamino)-6-chloropyrazolo[3,4-d]pyrimidin-1-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@@H](n2ncc3c(NCc4ccccc4)nc(Cl)nc32)[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C18H21ClFN5O8P2/c19-18-23-15(21-6-10-4-2-1-3-5-10)11-7-22-25(16(11)24-18)17-13(20)14(26)12(33-17)8-32-35(30,31)9-34(27,28)29/h1-5,7,12-14,17,26H,6,8-9H2,(H,30,31)(H,21,23,24)(H2,27,28,29)/t12-,13+,14-,17-/m1/s1 |
| InChIKey | UBIQPDYVNQTDMV-UMPJEAMMSA-N |
| XLogP | 2.03 |
| TPSA | 189.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.79 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|