C10H13N3OS — CID 130423805
2-sulfanylidene-5,6,8,9,10,10a-hexahydro-1H-pyrimido[5,4-g]indolizin-4-one (PubChem CID 130423805) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is 2-sulfanylidene-5,6,8,9,10,10a-hexahydro-1H-pyrimido[5,4-g]indolizin-4-one.
| Compound Name | 2-sulfanylidene-5,6,8,9,10,10a-hexahydro-1H-pyrimido[5,4-g]indolizin-4-one |
|---|---|
| PubChem CID | 130423805 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 2-sulfanylidene-5,6,8,9,10,10a-hexahydro-1H-pyrimido[5,4-g]indolizin-4-one |
| SMILES | O=c1[nH]c(=S)[nH]c2c1CCN1CCCC21 |
| InChI | InChI=1S/C10H13N3OS/c14-9-6-3-5-13-4-1-2-7(13)8(6)11-10(15)12-9/h7H,1-5H2,(H2,11,12,14,15) |
| InChIKey | AFXVAVBRCMPXCU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 51.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|