C34H48N10+2 — CID 130423907
(1,3-diethylimidazol-1-ium-2-yl)-[4-[5-[4-[(1,3-diethylimidazol-1-ium-2-yl)diazenyl]-2-methylphenyl]-1,5-diazocan-1-yl]-3-methylphenyl]diazene (PubChem CID 130423907) has the molecular formula C34H48N10+2 and a molecular weight of 596.83 g/mol. Its IUPAC name is (1,3-diethylimidazol-1-ium-2-yl)-[4-[5-[4-[(1,3-diethylimidazol-1-ium-2-yl)diazenyl]-2-methylphenyl]-1,5-diazocan-1-yl]-3-methylphenyl]diazene.
| Compound Name | (1,3-diethylimidazol-1-ium-2-yl)-[4-[5-[4-[(1,3-diethylimidazol-1-ium-2-yl)diazenyl]-2-methylphenyl]-1,5-diazocan-1-yl]-3-methylphenyl]diazene |
|---|---|
| PubChem CID | 130423907 |
| Molecular Formula | C34H48N10+2 |
| Molecular Weight | 596.83 g/mol |
| Exact Mass | 596.41 |
| IUPAC Name | (1,3-diethylimidazol-1-ium-2-yl)-[4-[5-[4-[(1,3-diethylimidazol-1-ium-2-yl)diazenyl]-2-methylphenyl]-1,5-diazocan-1-yl]-3-methylphenyl]diazene |
| SMILES | CCn1cc[n+](CC)c1/N=N/c1ccc(N2CCCN(c3ccc(/N=N/c4n(CC)cc[n+]4CC)cc3C)CCC2)c(C)c1 |
| InChI | InChI=1S/C34H48N10/c1-7-39-21-22-40(8-2)33(39)37-35-29-13-15-31(27(5)25-29)43-17-11-19-44(20-12-18-43)32-16-14-30(26-28(32)6)36-38-34-41(9-3)23-24-42(34)10-4/h13-16,21-26H,7-12,17-20H2,1-6H3/q+2 |
| InChIKey | XRBZXVOTCMIVTE-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 73.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.83 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|