About 5-(1H-benzimidazol-2-yl)-2-N-(2-nitrophenyl)-1,3-thiazole-2,4-diamine
5-(1H-benzimidazol-2-yl)-2-N-(2-nitrophenyl)-1,3-thiazole-2,4-diamine (PubChem CID 130424080) has the molecular formula C16H12N6O2S
and a molecular weight of 352.38 g/mol. Its IUPAC name is 5-(1H-benzimidazol-2-yl)-2-N-(2-nitrophenyl)-1,3-thiazole-2,4-diamine.
Molecular Properties
| Compound Name | 5-(1H-benzimidazol-2-yl)-2-N-(2-nitrophenyl)-1,3-thiazole-2,4-diamine |
| PubChem CID | 130424080 |
| Molecular Formula | C16H12N6O2S |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 5-(1H-benzimidazol-2-yl)-2-N-(2-nitrophenyl)-1,3-thiazole-2,4-diamine |
| SMILES | Nc1nc(Nc2ccccc2[N+](=O)[O-])sc1-c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H12N6O2S/c17-14-13(15-18-9-5-1-2-6-10(9)19-15)25-16(21-14)20-11-7-3-4-8-12(11)22(23)24/h1-8H,17H2,(H,18,19)(H,20,21) |
| InChIKey | JIPRDBQRBKCMAK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(1H-benzimidazol-2-yl)-2-N-(2-nitrophenyl)-1,3-thiazole-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1H-benzimidazol-2-yl)-2-N-(2-nitrophenyl)-1,3-thiazole-2,4-diamine?
The IUPAC name of 5-(1H-benzimidazol-2-yl)-2-N-(2-nitrophenyl)-1,3-thiazole-2,4-diamine (CID 130424080) is 5-(1H-benzimidazol-2-yl)-2-N-(2-nitrophenyl)-1,3-thiazole-2,4-diamine.
What is the SMILES notation for 5-(1H-benzimidazol-2-yl)-2-N-(2-nitrophenyl)-1,3-thiazole-2,4-diamine?
The canonical SMILES for 5-(1H-benzimidazol-2-yl)-2-N-(2-nitrophenyl)-1,3-thiazole-2,4-diamine is Nc1nc(Nc2ccccc2[N+](=O)[O-])sc1-c1nc2ccccc2[nH]1.
What is the InChIKey of 5-(1H-benzimidazol-2-yl)-2-N-(2-nitrophenyl)-1,3-thiazole-2,4-diamine?
The InChIKey is JIPRDBQRBKCMAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N6O2S/c17-14-13(15-18-9-5-1-2-6-10(9)19-15)25-16(21-14)20-11-7-3-4-8-12(11)22(23)24/h1-8H,17H2,(H,18,19)(H,20,21).
What are the key properties of 5-(1H-benzimidazol-2-yl)-2-N-(2-nitrophenyl)-1,3-thiazole-2,4-diamine?
5-(1H-benzimidazol-2-yl)-2-N-(2-nitrophenyl)-1,3-thiazole-2,4-diamine has a molecular weight of 352.38 g/mol, XLogP of 3.92, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1H-benzimidazol-2-yl)-2-N-(2-nitrophenyl)-1,3-thiazole-2,4-diamine is sourced from PubChem (CID 130424080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).