About N,N-diethyl-N'-methylmethanimidamide
N,N-diethyl-N'-methylmethanimidamide (PubChem CID 13042425) has the molecular formula C6H14N2
and a molecular weight of 114.19 g/mol. Its IUPAC name is N,N-diethyl-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N,N-diethyl-N'-methylmethanimidamide |
| PubChem CID | 13042425 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | N,N-diethyl-N'-methylmethanimidamide |
| SMILES | CCN(/C=N/C)CC |
| InChI | InChI=1S/C6H14N2/c1-4-8(5-2)6-7-3/h6H,4-5H2,1-3H3/b7-6+ |
| InChIKey | PPIGIWCTZQUVLD-VOTSOKGWSA-N |
| XLogP | 0.99 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyl-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-N'-methylmethanimidamide?
The IUPAC name of N,N-diethyl-N'-methylmethanimidamide (CID 13042425) is N,N-diethyl-N'-methylmethanimidamide.
What is the SMILES notation for N,N-diethyl-N'-methylmethanimidamide?
The canonical SMILES for N,N-diethyl-N'-methylmethanimidamide is CCN(/C=N/C)CC.
What is the InChIKey of N,N-diethyl-N'-methylmethanimidamide?
The InChIKey is PPIGIWCTZQUVLD-VOTSOKGWSA-N. The full InChI is InChI=1S/C6H14N2/c1-4-8(5-2)6-7-3/h6H,4-5H2,1-3H3/b7-6+.
What are the key properties of N,N-diethyl-N'-methylmethanimidamide?
N,N-diethyl-N'-methylmethanimidamide has a molecular weight of 114.19 g/mol, XLogP of 0.99, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-N'-methylmethanimidamide is sourced from PubChem (CID 13042425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).