About 2-[(2E,4E)-7-[3-(3-methoxypentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]oxane
2-[(2E,4E)-7-[3-(3-methoxypentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]oxane (PubChem CID 130424762) has the molecular formula C20H34O3
and a molecular weight of 322.49 g/mol. Its IUPAC name is 2-[(2E,4E)-7-[3-(3-methoxypentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]oxane.
Molecular Properties
| Compound Name | 2-[(2E,4E)-7-[3-(3-methoxypentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]oxane |
| PubChem CID | 130424762 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 2-[(2E,4E)-7-[3-(3-methoxypentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]oxane |
| SMILES | CCC(OC)C(C)C1OC1CC/C=C/C=C(\C)C1CCCCO1 |
| InChI | InChI=1S/C20H34O3/c1-5-17(21-4)16(3)20-19(23-20)13-8-6-7-11-15(2)18-12-9-10-14-22-18/h6-7,11,16-20H,5,8-10,12-14H2,1-4H3/b7-6+,15-11+ |
| InChIKey | VYOHNZLDTJPVQY-IIWXPVLZSA-N |
| XLogP | 4.67 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2E,4E)-7-[3-(3-methoxypentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2E,4E)-7-[3-(3-methoxypentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]oxane?
The IUPAC name of 2-[(2E,4E)-7-[3-(3-methoxypentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]oxane (CID 130424762) is 2-[(2E,4E)-7-[3-(3-methoxypentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]oxane.
What is the SMILES notation for 2-[(2E,4E)-7-[3-(3-methoxypentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]oxane?
The canonical SMILES for 2-[(2E,4E)-7-[3-(3-methoxypentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]oxane is CCC(OC)C(C)C1OC1CC/C=C/C=C(\C)C1CCCCO1.
What is the InChIKey of 2-[(2E,4E)-7-[3-(3-methoxypentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]oxane?
The InChIKey is VYOHNZLDTJPVQY-IIWXPVLZSA-N. The full InChI is InChI=1S/C20H34O3/c1-5-17(21-4)16(3)20-19(23-20)13-8-6-7-11-15(2)18-12-9-10-14-22-18/h6-7,11,16-20H,5,8-10,12-14H2,1-4H3/b7-6+,15-11+.
What are the key properties of 2-[(2E,4E)-7-[3-(3-methoxypentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]oxane?
2-[(2E,4E)-7-[3-(3-methoxypentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]oxane has a molecular weight of 322.49 g/mol, XLogP of 4.67, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2E,4E)-7-[3-(3-methoxypentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]oxane is sourced from PubChem (CID 130424762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).