About 1-(2,3-dimethoxy-5-methylphenyl)-5-iodo-2,3-dimethoxybenzene
1-(2,3-dimethoxy-5-methylphenyl)-5-iodo-2,3-dimethoxybenzene (PubChem CID 130424971) has the molecular formula C17H19IO4
and a molecular weight of 414.24 g/mol. Its IUPAC name is 1-(2,3-dimethoxy-5-methylphenyl)-5-iodo-2,3-dimethoxybenzene.
Molecular Properties
| Compound Name | 1-(2,3-dimethoxy-5-methylphenyl)-5-iodo-2,3-dimethoxybenzene |
| PubChem CID | 130424971 |
| Molecular Formula | C17H19IO4 |
| Molecular Weight | 414.24 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 1-(2,3-dimethoxy-5-methylphenyl)-5-iodo-2,3-dimethoxybenzene |
| SMILES | COc1cc(C)cc(-c2cc(I)cc(OC)c2OC)c1OC |
| InChI | InChI=1S/C17H19IO4/c1-10-6-12(16(21-4)14(7-10)19-2)13-8-11(18)9-15(20-3)17(13)22-5/h6-9H,1-5H3 |
| InChIKey | DYFAEJXUMVEKCC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.24 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,3-dimethoxy-5-methylphenyl)-5-iodo-2,3-dimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dimethoxy-5-methylphenyl)-5-iodo-2,3-dimethoxybenzene?
The IUPAC name of 1-(2,3-dimethoxy-5-methylphenyl)-5-iodo-2,3-dimethoxybenzene (CID 130424971) is 1-(2,3-dimethoxy-5-methylphenyl)-5-iodo-2,3-dimethoxybenzene.
What is the SMILES notation for 1-(2,3-dimethoxy-5-methylphenyl)-5-iodo-2,3-dimethoxybenzene?
The canonical SMILES for 1-(2,3-dimethoxy-5-methylphenyl)-5-iodo-2,3-dimethoxybenzene is COc1cc(C)cc(-c2cc(I)cc(OC)c2OC)c1OC.
What is the InChIKey of 1-(2,3-dimethoxy-5-methylphenyl)-5-iodo-2,3-dimethoxybenzene?
The InChIKey is DYFAEJXUMVEKCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19IO4/c1-10-6-12(16(21-4)14(7-10)19-2)13-8-11(18)9-15(20-3)17(13)22-5/h6-9H,1-5H3.
What are the key properties of 1-(2,3-dimethoxy-5-methylphenyl)-5-iodo-2,3-dimethoxybenzene?
1-(2,3-dimethoxy-5-methylphenyl)-5-iodo-2,3-dimethoxybenzene has a molecular weight of 414.24 g/mol, XLogP of 4.30, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dimethoxy-5-methylphenyl)-5-iodo-2,3-dimethoxybenzene is sourced from PubChem (CID 130424971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).