C20H26F3NO2S — CID 130425083
(E)-4-(5-methoxy-4-methyl-2-methylidenepentyl)sulfanyl-2-methyl-N-(3,4,5-trifluorophenyl)pent-3-enamide (PubChem CID 130425083) has the molecular formula C20H26F3NO2S and a molecular weight of 401.49 g/mol. Its IUPAC name is (E)-4-(5-methoxy-4-methyl-2-methylidenepentyl)sulfanyl-2-methyl-N-(3,4,5-trifluorophenyl)pent-3-enamide.
| Compound Name | (E)-4-(5-methoxy-4-methyl-2-methylidenepentyl)sulfanyl-2-methyl-N-(3,4,5-trifluorophenyl)pent-3-enamide |
|---|---|
| PubChem CID | 130425083 |
| Molecular Formula | C20H26F3NO2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (E)-4-(5-methoxy-4-methyl-2-methylidenepentyl)sulfanyl-2-methyl-N-(3,4,5-trifluorophenyl)pent-3-enamide |
| SMILES | C=C(CS/C(C)=C/C(C)C(=O)Nc1cc(F)c(F)c(F)c1)CC(C)COC |
| InChI | InChI=1S/C20H26F3NO2S/c1-12(10-26-5)6-13(2)11-27-15(4)7-14(3)20(25)24-16-8-17(21)19(23)18(22)9-16/h7-9,12,14H,2,6,10-11H2,1,3-5H3,(H,24,25)/b15-7+ |
| InChIKey | SVUBAECRVWEELH-VIZOYTHASA-N |
| XLogP | 5.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|