C9H11FN5O2P — CID 130426096
8-[3-fluoro-2-(phosphorosomethoxy)propyl]pyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 130426096) has the molecular formula C9H11FN5O2P and a molecular weight of 271.19 g/mol. Its IUPAC name is 8-[3-fluoro-2-(phosphorosomethoxy)propyl]pyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | 8-[3-fluoro-2-(phosphorosomethoxy)propyl]pyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 130426096 |
| Molecular Formula | C9H11FN5O2P |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 8-[3-fluoro-2-(phosphorosomethoxy)propyl]pyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | Nc1ncnc2c(CC(CF)OCP=O)cnn12 |
| InChI | InChI=1S/C9H11FN5O2P/c10-2-7(17-5-18-16)1-6-3-14-15-8(6)12-4-13-9(15)11/h3-4,7H,1-2,5H2,(H2,11,12,13) |
| InChIKey | LKULAUYIILTHEK-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|