C17H29NO2 — CID 130426468
(4Z,6E)-1-(2-cyclohexylethylamino)nona-4,6,8-triene-2,6-diol (PubChem CID 130426468) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is (4Z,6E)-1-(2-cyclohexylethylamino)nona-4,6,8-triene-2,6-diol.
| Compound Name | (4Z,6E)-1-(2-cyclohexylethylamino)nona-4,6,8-triene-2,6-diol |
|---|---|
| PubChem CID | 130426468 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | (4Z,6E)-1-(2-cyclohexylethylamino)nona-4,6,8-triene-2,6-diol |
| SMILES | C=C/C=C(O)\C=C/CC(O)CNCCC1CCCCC1 |
| InChI | InChI=1S/C17H29NO2/c1-2-7-16(19)10-6-11-17(20)14-18-13-12-15-8-4-3-5-9-15/h2,6-7,10,15,17-20H,1,3-5,8-9,11-14H2/b10-6-,16-7+ |
| InChIKey | MQMBHONSCYKBCA-YRTLORKOSA-N |
| XLogP | 3.48 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|