C9H19N2O2S- — CID 130426474
4-(tert-butylamino)piperidine-1-sulfinate (PubChem CID 130426474) has the molecular formula C9H19N2O2S- and a molecular weight of 219.33 g/mol. Its IUPAC name is 4-(tert-butylamino)piperidine-1-sulfinate.
| Compound Name | 4-(tert-butylamino)piperidine-1-sulfinate |
|---|---|
| PubChem CID | 130426474 |
| Molecular Formula | C9H19N2O2S- |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 4-(tert-butylamino)piperidine-1-sulfinate |
| SMILES | CC(C)(C)NC1CCN(S(=O)[O-])CC1 |
| InChI | InChI=1S/C9H20N2O2S/c1-9(2,3)10-8-4-6-11(7-5-8)14(12)13/h8,10H,4-7H2,1-3H3,(H,12,13)/p-1 |
| InChIKey | BGOJWTHBHDZRTP-UHFFFAOYSA-M |
| XLogP | 0.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|